C18H21NO7 — CID 89432107
5-[(4R)-7-(2-methylprop-2-enoyloxymethyl)-1,3-dioxo-4,7a-dihydro-3aH-4,7-epoxyisoindol-2-yl]pentanoic acid (PubChem CID 89432107) has the molecular formula C18H21NO7 and a molecular weight of 363.37 g/mol. Its IUPAC name is 5-[(4R)-7-(2-methylprop-2-enoyloxymethyl)-1,3-dioxo-4,7a-dihydro-3aH-4,7-epoxyisoindol-2-yl]pentanoic acid.
| Compound Name | 5-[(4R)-7-(2-methylprop-2-enoyloxymethyl)-1,3-dioxo-4,7a-dihydro-3aH-4,7-epoxyisoindol-2-yl]pentanoic acid |
|---|---|
| PubChem CID | 89432107 |
| Molecular Formula | C18H21NO7 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 5-[(4R)-7-(2-methylprop-2-enoyloxymethyl)-1,3-dioxo-4,7a-dihydro-3aH-4,7-epoxyisoindol-2-yl]pentanoic acid |
| SMILES | C=C(C)C(=O)OCC12C=C[C@@H](O1)C1C(=O)N(CCCCC(=O)O)C(=O)C12 |
| InChI | InChI=1S/C18H21NO7/c1-10(2)17(24)25-9-18-7-6-11(26-18)13-14(18)16(23)19(15(13)22)8-4-3-5-12(20)21/h6-7,11,13-14H,1,3-5,8-9H2,2H3,(H,20,21)/t11-,13?,14?,18?/m1/s1 |
| InChIKey | QWVHWQWKZWTZIJ-ZLNHHVGESA-N |
| XLogP | 0.67 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|