C17H23N2O7P — CID 89432113
2-[7-methyl-2-[2-(2-methylprop-2-enoylamino)ethyl]-1,3-dioxo-3a,7a-dihydro-4,7-epoxyisoindol-4-yl]ethylphosphonic acid (PubChem CID 89432113) has the molecular formula C17H23N2O7P and a molecular weight of 398.35 g/mol. Its IUPAC name is 2-[7-methyl-2-[2-(2-methylprop-2-enoylamino)ethyl]-1,3-dioxo-3a,7a-dihydro-4,7-epoxyisoindol-4-yl]ethylphosphonic acid.
| Compound Name | 2-[7-methyl-2-[2-(2-methylprop-2-enoylamino)ethyl]-1,3-dioxo-3a,7a-dihydro-4,7-epoxyisoindol-4-yl]ethylphosphonic acid |
|---|---|
| PubChem CID | 89432113 |
| Molecular Formula | C17H23N2O7P |
| Molecular Weight | 398.35 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 2-[7-methyl-2-[2-(2-methylprop-2-enoylamino)ethyl]-1,3-dioxo-3a,7a-dihydro-4,7-epoxyisoindol-4-yl]ethylphosphonic acid |
| SMILES | C=C(C)C(=O)NCCN1C(=O)C2C(C1=O)C1(CCP(=O)(O)O)C=CC2(C)O1 |
| InChI | InChI=1S/C17H23N2O7P/c1-10(2)13(20)18-7-8-19-14(21)11-12(15(19)22)17(6-9-27(23,24)25)5-4-16(11,3)26-17/h4-5,11-12H,1,6-9H2,2-3H3,(H,18,20)(H2,23,24,25) |
| InChIKey | KYGQQPVUUZDHSQ-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.35 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|