About triethoxy-[2-[2-[ethoxy(methyl)phosphoryl]-2,4-dihydro-1,3-benzoxazin-3-yl]ethyl]silane
triethoxy-[2-[2-[ethoxy(methyl)phosphoryl]-2,4-dihydro-1,3-benzoxazin-3-yl]ethyl]silane (PubChem CID 89432188) has the molecular formula C19H34NO6PSi
and a molecular weight of 431.54 g/mol. Its IUPAC name is triethoxy-[2-[2-[ethoxy(methyl)phosphoryl]-2,4-dihydro-1,3-benzoxazin-3-yl]ethyl]silane.
Molecular Properties
| Compound Name | triethoxy-[2-[2-[ethoxy(methyl)phosphoryl]-2,4-dihydro-1,3-benzoxazin-3-yl]ethyl]silane |
| PubChem CID | 89432188 |
| Molecular Formula | C19H34NO6PSi |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | triethoxy-[2-[2-[ethoxy(methyl)phosphoryl]-2,4-dihydro-1,3-benzoxazin-3-yl]ethyl]silane |
| SMILES | CCO[Si](CCN1Cc2ccccc2OC1P(C)(=O)OCC)(OCC)OCC |
| InChI | InChI=1S/C19H34NO6PSi/c1-6-22-27(5,21)19-20(16-17-12-10-11-13-18(17)26-19)14-15-28(23-7-2,24-8-3)25-9-4/h10-13,19H,6-9,14-16H2,1-5H3 |
| InChIKey | PHFIFTVUVOPHPQ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze triethoxy-[2-[2-[ethoxy(methyl)phosphoryl]-2,4-dihydro-1,3-benzoxazin-3-yl]ethyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethoxy-[2-[2-[ethoxy(methyl)phosphoryl]-2,4-dihydro-1,3-benzoxazin-3-yl]ethyl]silane?
The IUPAC name of triethoxy-[2-[2-[ethoxy(methyl)phosphoryl]-2,4-dihydro-1,3-benzoxazin-3-yl]ethyl]silane (CID 89432188) is triethoxy-[2-[2-[ethoxy(methyl)phosphoryl]-2,4-dihydro-1,3-benzoxazin-3-yl]ethyl]silane.
What is the SMILES notation for triethoxy-[2-[2-[ethoxy(methyl)phosphoryl]-2,4-dihydro-1,3-benzoxazin-3-yl]ethyl]silane?
The canonical SMILES for triethoxy-[2-[2-[ethoxy(methyl)phosphoryl]-2,4-dihydro-1,3-benzoxazin-3-yl]ethyl]silane is CCO[Si](CCN1Cc2ccccc2OC1P(C)(=O)OCC)(OCC)OCC.
What is the InChIKey of triethoxy-[2-[2-[ethoxy(methyl)phosphoryl]-2,4-dihydro-1,3-benzoxazin-3-yl]ethyl]silane?
The InChIKey is PHFIFTVUVOPHPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H34NO6PSi/c1-6-22-27(5,21)19-20(16-17-12-10-11-13-18(17)26-19)14-15-28(23-7-2,24-8-3)25-9-4/h10-13,19H,6-9,14-16H2,1-5H3.
What are the key properties of triethoxy-[2-[2-[ethoxy(methyl)phosphoryl]-2,4-dihydro-1,3-benzoxazin-3-yl]ethyl]silane?
triethoxy-[2-[2-[ethoxy(methyl)phosphoryl]-2,4-dihydro-1,3-benzoxazin-3-yl]ethyl]silane has a molecular weight of 431.54 g/mol, XLogP of 4.16, 12 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for triethoxy-[2-[2-[ethoxy(methyl)phosphoryl]-2,4-dihydro-1,3-benzoxazin-3-yl]ethyl]silane is sourced from PubChem (CID 89432188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).