C31H44N2O3 — CID 89432240
(E)-1-[4-[(4Z,7Z,10Z,13Z,16Z,18Z)-docosa-4,7,10,13,16,18-hexaenoyl]piperazin-1-yl]pent-2-ene-1,4-dione (PubChem CID 89432240) has the molecular formula C31H44N2O3 and a molecular weight of 492.70 g/mol. Its IUPAC name is (E)-1-[4-[(4Z,7Z,10Z,13Z,16Z,18Z)-docosa-4,7,10,13,16,18-hexaenoyl]piperazin-1-yl]pent-2-ene-1,4-dione.
| Compound Name | (E)-1-[4-[(4Z,7Z,10Z,13Z,16Z,18Z)-docosa-4,7,10,13,16,18-hexaenoyl]piperazin-1-yl]pent-2-ene-1,4-dione |
|---|---|
| PubChem CID | 89432240 |
| Molecular Formula | C31H44N2O3 |
| Molecular Weight | 492.70 g/mol |
| Exact Mass | 492.34 |
| IUPAC Name | (E)-1-[4-[(4Z,7Z,10Z,13Z,16Z,18Z)-docosa-4,7,10,13,16,18-hexaenoyl]piperazin-1-yl]pent-2-ene-1,4-dione |
| SMILES | CCC/C=C\C=C/C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)N1CCN(C(=O)/C=C/C(C)=O)CC1 |
| InChI | InChI=1S/C31H44N2O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-30(35)32-25-27-33(28-26-32)31(36)24-23-29(2)34/h5-8,10-11,13-14,16-17,19-20,23-24H,3-4,9,12,15,18,21-22,25-28H2,1-2H3/b6-5-,8-7-,11-10-,14-13-,17-16-,20-19-,24-23+ |
| InChIKey | VKZDTECQPHTBOF-QYVBXWABSA-N |
| XLogP | 6.28 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.70 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|