About N,N-dimethyl-1-[(2S,4R)-4-propan-2-ylpyrrolidin-2-yl]ethenamine
N,N-dimethyl-1-[(2S,4R)-4-propan-2-ylpyrrolidin-2-yl]ethenamine (PubChem CID 89432904) has the molecular formula C11H22N2
and a molecular weight of 182.31 g/mol. Its IUPAC name is N,N-dimethyl-1-[(2S,4R)-4-propan-2-ylpyrrolidin-2-yl]ethenamine.
Molecular Properties
| Compound Name | N,N-dimethyl-1-[(2S,4R)-4-propan-2-ylpyrrolidin-2-yl]ethenamine |
| PubChem CID | 89432904 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | N,N-dimethyl-1-[(2S,4R)-4-propan-2-ylpyrrolidin-2-yl]ethenamine |
| SMILES | C=C([C@@H]1C[C@H](C(C)C)CN1)N(C)C |
| InChI | InChI=1S/C11H22N2/c1-8(2)10-6-11(12-7-10)9(3)13(4)5/h8,10-12H,3,6-7H2,1-2,4-5H3/t10-,11-/m0/s1 |
| InChIKey | NNUQTGCIUOTHFM-QWRGUYRKSA-N |
| XLogP | 1.70 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N-dimethyl-1-[(2S,4R)-4-propan-2-ylpyrrolidin-2-yl]ethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-1-[(2S,4R)-4-propan-2-ylpyrrolidin-2-yl]ethenamine?
The IUPAC name of N,N-dimethyl-1-[(2S,4R)-4-propan-2-ylpyrrolidin-2-yl]ethenamine (CID 89432904) is N,N-dimethyl-1-[(2S,4R)-4-propan-2-ylpyrrolidin-2-yl]ethenamine.
What is the SMILES notation for N,N-dimethyl-1-[(2S,4R)-4-propan-2-ylpyrrolidin-2-yl]ethenamine?
The canonical SMILES for N,N-dimethyl-1-[(2S,4R)-4-propan-2-ylpyrrolidin-2-yl]ethenamine is C=C([C@@H]1C[C@H](C(C)C)CN1)N(C)C.
What is the InChIKey of N,N-dimethyl-1-[(2S,4R)-4-propan-2-ylpyrrolidin-2-yl]ethenamine?
The InChIKey is NNUQTGCIUOTHFM-QWRGUYRKSA-N. The full InChI is InChI=1S/C11H22N2/c1-8(2)10-6-11(12-7-10)9(3)13(4)5/h8,10-12H,3,6-7H2,1-2,4-5H3/t10-,11-/m0/s1.
What are the key properties of N,N-dimethyl-1-[(2S,4R)-4-propan-2-ylpyrrolidin-2-yl]ethenamine?
N,N-dimethyl-1-[(2S,4R)-4-propan-2-ylpyrrolidin-2-yl]ethenamine has a molecular weight of 182.31 g/mol, XLogP of 1.70, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-1-[(2S,4R)-4-propan-2-ylpyrrolidin-2-yl]ethenamine is sourced from PubChem (CID 89432904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).