About (Z)-5-methyl-4-oxo-N,N-bis[2-(propan-2-ylamino)ethyl]hex-2-enamide
(Z)-5-methyl-4-oxo-N,N-bis[2-(propan-2-ylamino)ethyl]hex-2-enamide (PubChem CID 89432998) has the molecular formula C17H33N3O2
and a molecular weight of 311.47 g/mol. Its IUPAC name is (Z)-5-methyl-4-oxo-N,N-bis[2-(propan-2-ylamino)ethyl]hex-2-enamide.
Molecular Properties
| Compound Name | (Z)-5-methyl-4-oxo-N,N-bis[2-(propan-2-ylamino)ethyl]hex-2-enamide |
| PubChem CID | 89432998 |
| Molecular Formula | C17H33N3O2 |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.26 |
| IUPAC Name | (Z)-5-methyl-4-oxo-N,N-bis[2-(propan-2-ylamino)ethyl]hex-2-enamide |
| SMILES | CC(C)NCCN(CCNC(C)C)C(=O)/C=C\C(=O)C(C)C |
| InChI | InChI=1S/C17H33N3O2/c1-13(2)16(21)7-8-17(22)20(11-9-18-14(3)4)12-10-19-15(5)6/h7-8,13-15,18-19H,9-12H2,1-6H3/b8-7- |
| InChIKey | PCYANXSAJSQLJB-FPLPWBNLSA-N |
| XLogP | 1.59 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-5-methyl-4-oxo-N,N-bis[2-(propan-2-ylamino)ethyl]hex-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-5-methyl-4-oxo-N,N-bis[2-(propan-2-ylamino)ethyl]hex-2-enamide?
The IUPAC name of (Z)-5-methyl-4-oxo-N,N-bis[2-(propan-2-ylamino)ethyl]hex-2-enamide (CID 89432998) is (Z)-5-methyl-4-oxo-N,N-bis[2-(propan-2-ylamino)ethyl]hex-2-enamide.
What is the SMILES notation for (Z)-5-methyl-4-oxo-N,N-bis[2-(propan-2-ylamino)ethyl]hex-2-enamide?
The canonical SMILES for (Z)-5-methyl-4-oxo-N,N-bis[2-(propan-2-ylamino)ethyl]hex-2-enamide is CC(C)NCCN(CCNC(C)C)C(=O)/C=C\C(=O)C(C)C.
What is the InChIKey of (Z)-5-methyl-4-oxo-N,N-bis[2-(propan-2-ylamino)ethyl]hex-2-enamide?
The InChIKey is PCYANXSAJSQLJB-FPLPWBNLSA-N. The full InChI is InChI=1S/C17H33N3O2/c1-13(2)16(21)7-8-17(22)20(11-9-18-14(3)4)12-10-19-15(5)6/h7-8,13-15,18-19H,9-12H2,1-6H3/b8-7-.
What are the key properties of (Z)-5-methyl-4-oxo-N,N-bis[2-(propan-2-ylamino)ethyl]hex-2-enamide?
(Z)-5-methyl-4-oxo-N,N-bis[2-(propan-2-ylamino)ethyl]hex-2-enamide has a molecular weight of 311.47 g/mol, XLogP of 1.59, 11 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-5-methyl-4-oxo-N,N-bis[2-(propan-2-ylamino)ethyl]hex-2-enamide is sourced from PubChem (CID 89432998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).