C14H22N2O3 — CID 89433162
(6E,8S,11S,12E)-11-methyl-8-propan-2-yl-1-oxa-4,9-diazacyclotrideca-6,12-diene-5,10-dione (PubChem CID 89433162) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is (6E,8S,11S,12E)-11-methyl-8-propan-2-yl-1-oxa-4,9-diazacyclotrideca-6,12-diene-5,10-dione.
| Compound Name | (6E,8S,11S,12E)-11-methyl-8-propan-2-yl-1-oxa-4,9-diazacyclotrideca-6,12-diene-5,10-dione |
|---|---|
| PubChem CID | 89433162 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | (6E,8S,11S,12E)-11-methyl-8-propan-2-yl-1-oxa-4,9-diazacyclotrideca-6,12-diene-5,10-dione |
| SMILES | CC(C)[C@H]1/C=C/C(=O)NCCO/C=C/[C@H](C)C(=O)N1 |
| InChI | InChI=1S/C14H22N2O3/c1-10(2)12-4-5-13(17)15-7-9-19-8-6-11(3)14(18)16-12/h4-6,8,10-12H,7,9H2,1-3H3,(H,15,17)(H,16,18)/b5-4+,8-6+/t11-,12+/m0/s1 |
| InChIKey | SWHPEFDPWLKGFA-RAGWDSSSSA-N |
| XLogP | 0.98 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |