About [(1S,8R)-9-bicyclo[6.1.0]non-4-ynyl]methyl N-[2-(2-tritioethoxy)ethyl]carbamate
[(1S,8R)-9-bicyclo[6.1.0]non-4-ynyl]methyl N-[2-(2-tritioethoxy)ethyl]carbamate (PubChem CID 89433368) has the molecular formula C15H23NO3
and a molecular weight of 267.36 g/mol. Its IUPAC name is [(1S,8R)-9-bicyclo[6.1.0]non-4-ynyl]methyl N-[2-(2-tritioethoxy)ethyl]carbamate.
Molecular Properties
| Compound Name | [(1S,8R)-9-bicyclo[6.1.0]non-4-ynyl]methyl N-[2-(2-tritioethoxy)ethyl]carbamate |
| PubChem CID | 89433368 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 267.36 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | [(1S,8R)-9-bicyclo[6.1.0]non-4-ynyl]methyl N-[2-(2-tritioethoxy)ethyl]carbamate |
| SMILES | [3H]CCOCCNC(=O)OCC1[C@H]2CCC#CCC[C@@H]12 |
| InChI | InChI=1S/C15H23NO3/c1-2-18-10-9-16-15(17)19-11-14-12-7-5-3-4-6-8-13(12)14/h12-14H,2,5-11H2,1H3,(H,16,17)/t12-,13+,14?/i1T |
| InChIKey | YQUAZQMNVWBOLD-DUQMGVLWSA-N |
| XLogP | 2.19 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.36 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [(1S,8R)-9-bicyclo[6.1.0]non-4-ynyl]methyl N-[2-(2-tritioethoxy)ethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,8R)-9-bicyclo[6.1.0]non-4-ynyl]methyl N-[2-(2-tritioethoxy)ethyl]carbamate?
The IUPAC name of [(1S,8R)-9-bicyclo[6.1.0]non-4-ynyl]methyl N-[2-(2-tritioethoxy)ethyl]carbamate (CID 89433368) is [(1S,8R)-9-bicyclo[6.1.0]non-4-ynyl]methyl N-[2-(2-tritioethoxy)ethyl]carbamate.
What is the SMILES notation for [(1S,8R)-9-bicyclo[6.1.0]non-4-ynyl]methyl N-[2-(2-tritioethoxy)ethyl]carbamate?
The canonical SMILES for [(1S,8R)-9-bicyclo[6.1.0]non-4-ynyl]methyl N-[2-(2-tritioethoxy)ethyl]carbamate is [3H]CCOCCNC(=O)OCC1[C@H]2CCC#CCC[C@@H]12.
What is the InChIKey of [(1S,8R)-9-bicyclo[6.1.0]non-4-ynyl]methyl N-[2-(2-tritioethoxy)ethyl]carbamate?
The InChIKey is YQUAZQMNVWBOLD-DUQMGVLWSA-N. The full InChI is InChI=1S/C15H23NO3/c1-2-18-10-9-16-15(17)19-11-14-12-7-5-3-4-6-8-13(12)14/h12-14H,2,5-11H2,1H3,(H,16,17)/t12-,13+,14?/i1T.
What are the key properties of [(1S,8R)-9-bicyclo[6.1.0]non-4-ynyl]methyl N-[2-(2-tritioethoxy)ethyl]carbamate?
[(1S,8R)-9-bicyclo[6.1.0]non-4-ynyl]methyl N-[2-(2-tritioethoxy)ethyl]carbamate has a molecular weight of 267.36 g/mol, XLogP of 2.19, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,8R)-9-bicyclo[6.1.0]non-4-ynyl]methyl N-[2-(2-tritioethoxy)ethyl]carbamate is sourced from PubChem (CID 89433368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).