About (3Z)-3-benzylidene-1,4-dimethyl-5-methylidenepyrrolidin-2-one
(3Z)-3-benzylidene-1,4-dimethyl-5-methylidenepyrrolidin-2-one (PubChem CID 89433414) has the molecular formula C14H15NO
and a molecular weight of 213.28 g/mol. Its IUPAC name is (3Z)-3-benzylidene-1,4-dimethyl-5-methylidenepyrrolidin-2-one.
Molecular Properties
| Compound Name | (3Z)-3-benzylidene-1,4-dimethyl-5-methylidenepyrrolidin-2-one |
| PubChem CID | 89433414 |
| Molecular Formula | C14H15NO |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | (3Z)-3-benzylidene-1,4-dimethyl-5-methylidenepyrrolidin-2-one |
| SMILES | C=C1C(C)/C(=C/c2ccccc2)C(=O)N1C |
| InChI | InChI=1S/C14H15NO/c1-10-11(2)15(3)14(16)13(10)9-12-7-5-4-6-8-12/h4-10H,2H2,1,3H3/b13-9- |
| InChIKey | FATLYXAEIRRGJL-LCYFTJDESA-N |
| XLogP | 2.69 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-3-benzylidene-1,4-dimethyl-5-methylidenepyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-3-benzylidene-1,4-dimethyl-5-methylidenepyrrolidin-2-one?
The IUPAC name of (3Z)-3-benzylidene-1,4-dimethyl-5-methylidenepyrrolidin-2-one (CID 89433414) is (3Z)-3-benzylidene-1,4-dimethyl-5-methylidenepyrrolidin-2-one.
What is the SMILES notation for (3Z)-3-benzylidene-1,4-dimethyl-5-methylidenepyrrolidin-2-one?
The canonical SMILES for (3Z)-3-benzylidene-1,4-dimethyl-5-methylidenepyrrolidin-2-one is C=C1C(C)/C(=C/c2ccccc2)C(=O)N1C.
What is the InChIKey of (3Z)-3-benzylidene-1,4-dimethyl-5-methylidenepyrrolidin-2-one?
The InChIKey is FATLYXAEIRRGJL-LCYFTJDESA-N. The full InChI is InChI=1S/C14H15NO/c1-10-11(2)15(3)14(16)13(10)9-12-7-5-4-6-8-12/h4-10H,2H2,1,3H3/b13-9-.
What are the key properties of (3Z)-3-benzylidene-1,4-dimethyl-5-methylidenepyrrolidin-2-one?
(3Z)-3-benzylidene-1,4-dimethyl-5-methylidenepyrrolidin-2-one has a molecular weight of 213.28 g/mol, XLogP of 2.69, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-3-benzylidene-1,4-dimethyl-5-methylidenepyrrolidin-2-one is sourced from PubChem (CID 89433414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).