C13H18F4O7S — CID 89433514
4-(4-acetyloxycyclohexanecarbonyl)oxy-1,1,2,2-tetrafluorobutane-1-sulfonic acid (PubChem CID 89433514) has the molecular formula C13H18F4O7S and a molecular weight of 394.34 g/mol. Its IUPAC name is 4-(4-acetyloxycyclohexanecarbonyl)oxy-1,1,2,2-tetrafluorobutane-1-sulfonic acid.
| Compound Name | 4-(4-acetyloxycyclohexanecarbonyl)oxy-1,1,2,2-tetrafluorobutane-1-sulfonic acid |
|---|---|
| PubChem CID | 89433514 |
| Molecular Formula | C13H18F4O7S |
| Molecular Weight | 394.34 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | 4-(4-acetyloxycyclohexanecarbonyl)oxy-1,1,2,2-tetrafluorobutane-1-sulfonic acid |
| SMILES | CC(=O)OC1CCC(C(=O)OCCC(F)(F)C(F)(F)S(=O)(=O)O)CC1 |
| InChI | InChI=1S/C13H18F4O7S/c1-8(18)24-10-4-2-9(3-5-10)11(19)23-7-6-12(14,15)13(16,17)25(20,21)22/h9-10H,2-7H2,1H3,(H,20,21,22) |
| InChIKey | GCHVCSIRSUNNBE-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.34 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|