About 6-chloro-2-[1-[4-[(2,5-difluorophenyl)methoxy]phenyl]ethyl]-1H-benzimidazole
6-chloro-2-[1-[4-[(2,5-difluorophenyl)methoxy]phenyl]ethyl]-1H-benzimidazole (PubChem CID 89433703) has the molecular formula C22H17ClF2N2O
and a molecular weight of 398.84 g/mol. Its IUPAC name is 6-chloro-2-[1-[4-[(2,5-difluorophenyl)methoxy]phenyl]ethyl]-1H-benzimidazole.
Molecular Properties
| Compound Name | 6-chloro-2-[1-[4-[(2,5-difluorophenyl)methoxy]phenyl]ethyl]-1H-benzimidazole |
| PubChem CID | 89433703 |
| Molecular Formula | C22H17ClF2N2O |
| Molecular Weight | 398.84 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 6-chloro-2-[1-[4-[(2,5-difluorophenyl)methoxy]phenyl]ethyl]-1H-benzimidazole |
| SMILES | CC(c1ccc(OCc2cc(F)ccc2F)cc1)c1nc2ccc(Cl)cc2[nH]1 |
| InChI | InChI=1S/C22H17ClF2N2O/c1-13(22-26-20-9-4-16(23)11-21(20)27-22)14-2-6-18(7-3-14)28-12-15-10-17(24)5-8-19(15)25/h2-11,13H,12H2,1H3,(H,26,27) |
| InChIKey | JCQMRQAMROOVNS-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.84 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-chloro-2-[1-[4-[(2,5-difluorophenyl)methoxy]phenyl]ethyl]-1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2-[1-[4-[(2,5-difluorophenyl)methoxy]phenyl]ethyl]-1H-benzimidazole?
The IUPAC name of 6-chloro-2-[1-[4-[(2,5-difluorophenyl)methoxy]phenyl]ethyl]-1H-benzimidazole (CID 89433703) is 6-chloro-2-[1-[4-[(2,5-difluorophenyl)methoxy]phenyl]ethyl]-1H-benzimidazole.
What is the SMILES notation for 6-chloro-2-[1-[4-[(2,5-difluorophenyl)methoxy]phenyl]ethyl]-1H-benzimidazole?
The canonical SMILES for 6-chloro-2-[1-[4-[(2,5-difluorophenyl)methoxy]phenyl]ethyl]-1H-benzimidazole is CC(c1ccc(OCc2cc(F)ccc2F)cc1)c1nc2ccc(Cl)cc2[nH]1.
What is the InChIKey of 6-chloro-2-[1-[4-[(2,5-difluorophenyl)methoxy]phenyl]ethyl]-1H-benzimidazole?
The InChIKey is JCQMRQAMROOVNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17ClF2N2O/c1-13(22-26-20-9-4-16(23)11-21(20)27-22)14-2-6-18(7-3-14)28-12-15-10-17(24)5-8-19(15)25/h2-11,13H,12H2,1H3,(H,26,27).
What are the key properties of 6-chloro-2-[1-[4-[(2,5-difluorophenyl)methoxy]phenyl]ethyl]-1H-benzimidazole?
6-chloro-2-[1-[4-[(2,5-difluorophenyl)methoxy]phenyl]ethyl]-1H-benzimidazole has a molecular weight of 398.84 g/mol, XLogP of 6.23, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2-[1-[4-[(2,5-difluorophenyl)methoxy]phenyl]ethyl]-1H-benzimidazole is sourced from PubChem (CID 89433703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).