About ethyl 5-chloro-6-[(2,6-dimethoxy-4-methylphenyl)methylamino]pyrimidine-4-carboxylate
ethyl 5-chloro-6-[(2,6-dimethoxy-4-methylphenyl)methylamino]pyrimidine-4-carboxylate (PubChem CID 89433921) has the molecular formula C17H20ClN3O4
and a molecular weight of 365.82 g/mol. Its IUPAC name is ethyl 5-chloro-6-[(2,6-dimethoxy-4-methylphenyl)methylamino]pyrimidine-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-chloro-6-[(2,6-dimethoxy-4-methylphenyl)methylamino]pyrimidine-4-carboxylate |
| PubChem CID | 89433921 |
| Molecular Formula | C17H20ClN3O4 |
| Molecular Weight | 365.82 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | ethyl 5-chloro-6-[(2,6-dimethoxy-4-methylphenyl)methylamino]pyrimidine-4-carboxylate |
| SMILES | CCOC(=O)c1ncnc(NCc2c(OC)cc(C)cc2OC)c1Cl |
| InChI | InChI=1S/C17H20ClN3O4/c1-5-25-17(22)15-14(18)16(21-9-20-15)19-8-11-12(23-3)6-10(2)7-13(11)24-4/h6-7,9H,5,8H2,1-4H3,(H,19,20,21) |
| InChIKey | UYEUSOOYJQPRJK-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.82 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 5-chloro-6-[(2,6-dimethoxy-4-methylphenyl)methylamino]pyrimidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-chloro-6-[(2,6-dimethoxy-4-methylphenyl)methylamino]pyrimidine-4-carboxylate?
The IUPAC name of ethyl 5-chloro-6-[(2,6-dimethoxy-4-methylphenyl)methylamino]pyrimidine-4-carboxylate (CID 89433921) is ethyl 5-chloro-6-[(2,6-dimethoxy-4-methylphenyl)methylamino]pyrimidine-4-carboxylate.
What is the SMILES notation for ethyl 5-chloro-6-[(2,6-dimethoxy-4-methylphenyl)methylamino]pyrimidine-4-carboxylate?
The canonical SMILES for ethyl 5-chloro-6-[(2,6-dimethoxy-4-methylphenyl)methylamino]pyrimidine-4-carboxylate is CCOC(=O)c1ncnc(NCc2c(OC)cc(C)cc2OC)c1Cl.
What is the InChIKey of ethyl 5-chloro-6-[(2,6-dimethoxy-4-methylphenyl)methylamino]pyrimidine-4-carboxylate?
The InChIKey is UYEUSOOYJQPRJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20ClN3O4/c1-5-25-17(22)15-14(18)16(21-9-20-15)19-8-11-12(23-3)6-10(2)7-13(11)24-4/h6-7,9H,5,8H2,1-4H3,(H,19,20,21).
What are the key properties of ethyl 5-chloro-6-[(2,6-dimethoxy-4-methylphenyl)methylamino]pyrimidine-4-carboxylate?
ethyl 5-chloro-6-[(2,6-dimethoxy-4-methylphenyl)methylamino]pyrimidine-4-carboxylate has a molecular weight of 365.82 g/mol, XLogP of 3.24, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-chloro-6-[(2,6-dimethoxy-4-methylphenyl)methylamino]pyrimidine-4-carboxylate is sourced from PubChem (CID 89433921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).