About ethyl 6-[(2,6-dimethoxy-4-methylphenyl)methylamino]pyrimidine-4-carboxylate
ethyl 6-[(2,6-dimethoxy-4-methylphenyl)methylamino]pyrimidine-4-carboxylate (PubChem CID 89433922) has the molecular formula C17H21N3O4
and a molecular weight of 331.37 g/mol. Its IUPAC name is ethyl 6-[(2,6-dimethoxy-4-methylphenyl)methylamino]pyrimidine-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 6-[(2,6-dimethoxy-4-methylphenyl)methylamino]pyrimidine-4-carboxylate |
| PubChem CID | 89433922 |
| Molecular Formula | C17H21N3O4 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | ethyl 6-[(2,6-dimethoxy-4-methylphenyl)methylamino]pyrimidine-4-carboxylate |
| SMILES | CCOC(=O)c1cc(NCc2c(OC)cc(C)cc2OC)ncn1 |
| InChI | InChI=1S/C17H21N3O4/c1-5-24-17(21)13-8-16(20-10-19-13)18-9-12-14(22-3)6-11(2)7-15(12)23-4/h6-8,10H,5,9H2,1-4H3,(H,18,19,20) |
| InChIKey | OCKLTVMBLSIPME-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 6-[(2,6-dimethoxy-4-methylphenyl)methylamino]pyrimidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-[(2,6-dimethoxy-4-methylphenyl)methylamino]pyrimidine-4-carboxylate?
The IUPAC name of ethyl 6-[(2,6-dimethoxy-4-methylphenyl)methylamino]pyrimidine-4-carboxylate (CID 89433922) is ethyl 6-[(2,6-dimethoxy-4-methylphenyl)methylamino]pyrimidine-4-carboxylate.
What is the SMILES notation for ethyl 6-[(2,6-dimethoxy-4-methylphenyl)methylamino]pyrimidine-4-carboxylate?
The canonical SMILES for ethyl 6-[(2,6-dimethoxy-4-methylphenyl)methylamino]pyrimidine-4-carboxylate is CCOC(=O)c1cc(NCc2c(OC)cc(C)cc2OC)ncn1.
What is the InChIKey of ethyl 6-[(2,6-dimethoxy-4-methylphenyl)methylamino]pyrimidine-4-carboxylate?
The InChIKey is OCKLTVMBLSIPME-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N3O4/c1-5-24-17(21)13-8-16(20-10-19-13)18-9-12-14(22-3)6-11(2)7-15(12)23-4/h6-8,10H,5,9H2,1-4H3,(H,18,19,20).
What are the key properties of ethyl 6-[(2,6-dimethoxy-4-methylphenyl)methylamino]pyrimidine-4-carboxylate?
ethyl 6-[(2,6-dimethoxy-4-methylphenyl)methylamino]pyrimidine-4-carboxylate has a molecular weight of 331.37 g/mol, XLogP of 2.59, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-[(2,6-dimethoxy-4-methylphenyl)methylamino]pyrimidine-4-carboxylate is sourced from PubChem (CID 89433922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).