C16H13F6N — CID 89434043
10-methyl-9,9-bis(trifluoromethyl)-3,4-dihydroacridine (PubChem CID 89434043) has the molecular formula C16H13F6N and a molecular weight of 333.28 g/mol. Its IUPAC name is 10-methyl-9,9-bis(trifluoromethyl)-3,4-dihydroacridine.
| Compound Name | 10-methyl-9,9-bis(trifluoromethyl)-3,4-dihydroacridine |
|---|---|
| PubChem CID | 89434043 |
| Molecular Formula | C16H13F6N |
| Molecular Weight | 333.28 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 10-methyl-9,9-bis(trifluoromethyl)-3,4-dihydroacridine |
| SMILES | CN1C2=C(C=CCC2)C(C(F)(F)F)(C(F)(F)F)c2ccccc21 |
| InChI | InChI=1S/C16H13F6N/c1-23-12-8-4-2-6-10(12)14(15(17,18)19,16(20,21)22)11-7-3-5-9-13(11)23/h2-4,6-8H,5,9H2,1H3 |
| InChIKey | MQDTWWCGWQDDRR-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.28 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |