About 10-methyl-9,9-bis(trifluoromethyl)-3,4-dihydroacridine
10-methyl-9,9-bis(trifluoromethyl)-3,4-dihydroacridine (PubChem CID 89434043) has the molecular formula C16H13F6N
and a molecular weight of 333.28 g/mol. Its IUPAC name is 10-methyl-9,9-bis(trifluoromethyl)-3,4-dihydroacridine.
Molecular Properties
| Compound Name | 10-methyl-9,9-bis(trifluoromethyl)-3,4-dihydroacridine |
| PubChem CID | 89434043 |
| Molecular Formula | C16H13F6N |
| Molecular Weight | 333.28 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 10-methyl-9,9-bis(trifluoromethyl)-3,4-dihydroacridine |
| SMILES | CN1C2=C(C=CCC2)C(C(F)(F)F)(C(F)(F)F)c2ccccc21 |
| InChI | InChI=1S/C16H13F6N/c1-23-12-8-4-2-6-10(12)14(15(17,18)19,16(20,21)22)11-7-3-5-9-13(11)23/h2-4,6-8H,5,9H2,1H3 |
| InChIKey | MQDTWWCGWQDDRR-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 333.28 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 10-methyl-9,9-bis(trifluoromethyl)-3,4-dihydroacridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-methyl-9,9-bis(trifluoromethyl)-3,4-dihydroacridine?
The IUPAC name of 10-methyl-9,9-bis(trifluoromethyl)-3,4-dihydroacridine (CID 89434043) is 10-methyl-9,9-bis(trifluoromethyl)-3,4-dihydroacridine.
What is the SMILES notation for 10-methyl-9,9-bis(trifluoromethyl)-3,4-dihydroacridine?
The canonical SMILES for 10-methyl-9,9-bis(trifluoromethyl)-3,4-dihydroacridine is CN1C2=C(C=CCC2)C(C(F)(F)F)(C(F)(F)F)c2ccccc21.
What is the InChIKey of 10-methyl-9,9-bis(trifluoromethyl)-3,4-dihydroacridine?
The InChIKey is MQDTWWCGWQDDRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13F6N/c1-23-12-8-4-2-6-10(12)14(15(17,18)19,16(20,21)22)11-7-3-5-9-13(11)23/h2-4,6-8H,5,9H2,1H3.
What are the key properties of 10-methyl-9,9-bis(trifluoromethyl)-3,4-dihydroacridine?
10-methyl-9,9-bis(trifluoromethyl)-3,4-dihydroacridine has a molecular weight of 333.28 g/mol, XLogP of 5.10, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 10-methyl-9,9-bis(trifluoromethyl)-3,4-dihydroacridine is sourced from PubChem (CID 89434043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).