C22H23FN4O3 — CID 89434330
tert-butyl 4-[4-(4-amino-2-fluorophenoxy)-2-cyano-3-pyridinyl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 89434330) has the molecular formula C22H23FN4O3 and a molecular weight of 410.45 g/mol. Its IUPAC name is tert-butyl 4-[4-(4-amino-2-fluorophenoxy)-2-cyano-3-pyridinyl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-(4-amino-2-fluorophenoxy)-2-cyano-3-pyridinyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 89434330 |
| Molecular Formula | C22H23FN4O3 |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | tert-butyl 4-[4-(4-amino-2-fluorophenoxy)-2-cyano-3-pyridinyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC=C(c2c(Oc3ccc(N)cc3F)ccnc2C#N)CC1 |
| InChI | InChI=1S/C22H23FN4O3/c1-22(2,3)30-21(28)27-10-7-14(8-11-27)20-17(13-24)26-9-6-19(20)29-18-5-4-15(25)12-16(18)23/h4-7,9,12H,8,10-11,25H2,1-3H3 |
| InChIKey | YORPWVCDMZULSW-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 101.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|