About [(3S,4S,5R)-5-(azidomethyl)-4-ethoxyoxolan-3-yl] trifluoromethanesulfonate
[(3S,4S,5R)-5-(azidomethyl)-4-ethoxyoxolan-3-yl] trifluoromethanesulfonate (PubChem CID 89434863) has the molecular formula C8H12F3N3O5S
and a molecular weight of 319.26 g/mol. Its IUPAC name is [(3S,4S,5R)-5-(azidomethyl)-4-ethoxyoxolan-3-yl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [(3S,4S,5R)-5-(azidomethyl)-4-ethoxyoxolan-3-yl] trifluoromethanesulfonate |
| PubChem CID | 89434863 |
| Molecular Formula | C8H12F3N3O5S |
| Molecular Weight | 319.26 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | [(3S,4S,5R)-5-(azidomethyl)-4-ethoxyoxolan-3-yl] trifluoromethanesulfonate |
| SMILES | CCO[C@@H]1[C@@H](OS(=O)(=O)C(F)(F)F)CO[C@@H]1CN=[N+]=[N-] |
| InChI | InChI=1S/C8H12F3N3O5S/c1-2-17-7-5(3-13-14-12)18-4-6(7)19-20(15,16)8(9,10)11/h5-7H,2-4H2,1H3/t5-,6+,7+/m1/s1 |
| InChIKey | BMOQFOIXSGHXCB-VQVTYTSYSA-N |
| XLogP | 1.34 |
| TPSA | 110.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.26 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [(3S,4S,5R)-5-(azidomethyl)-4-ethoxyoxolan-3-yl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,4S,5R)-5-(azidomethyl)-4-ethoxyoxolan-3-yl] trifluoromethanesulfonate?
The IUPAC name of [(3S,4S,5R)-5-(azidomethyl)-4-ethoxyoxolan-3-yl] trifluoromethanesulfonate (CID 89434863) is [(3S,4S,5R)-5-(azidomethyl)-4-ethoxyoxolan-3-yl] trifluoromethanesulfonate.
What is the SMILES notation for [(3S,4S,5R)-5-(azidomethyl)-4-ethoxyoxolan-3-yl] trifluoromethanesulfonate?
The canonical SMILES for [(3S,4S,5R)-5-(azidomethyl)-4-ethoxyoxolan-3-yl] trifluoromethanesulfonate is CCO[C@@H]1[C@@H](OS(=O)(=O)C(F)(F)F)CO[C@@H]1CN=[N+]=[N-].
What is the InChIKey of [(3S,4S,5R)-5-(azidomethyl)-4-ethoxyoxolan-3-yl] trifluoromethanesulfonate?
The InChIKey is BMOQFOIXSGHXCB-VQVTYTSYSA-N. The full InChI is InChI=1S/C8H12F3N3O5S/c1-2-17-7-5(3-13-14-12)18-4-6(7)19-20(15,16)8(9,10)11/h5-7H,2-4H2,1H3/t5-,6+,7+/m1/s1.
What are the key properties of [(3S,4S,5R)-5-(azidomethyl)-4-ethoxyoxolan-3-yl] trifluoromethanesulfonate?
[(3S,4S,5R)-5-(azidomethyl)-4-ethoxyoxolan-3-yl] trifluoromethanesulfonate has a molecular weight of 319.26 g/mol, XLogP of 1.34, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,4S,5R)-5-(azidomethyl)-4-ethoxyoxolan-3-yl] trifluoromethanesulfonate is sourced from PubChem (CID 89434863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).