C9H12N2S2 — CID 89435411
4-[(1Z,3E)-1-(methylamino)penta-1,3-dien-3-yl]-3H-1,3-thiazole-2-thione (PubChem CID 89435411) has the molecular formula C9H12N2S2 and a molecular weight of 212.34 g/mol. Its IUPAC name is 4-[(1Z,3E)-1-(methylamino)penta-1,3-dien-3-yl]-3H-1,3-thiazole-2-thione.
| Compound Name | 4-[(1Z,3E)-1-(methylamino)penta-1,3-dien-3-yl]-3H-1,3-thiazole-2-thione |
|---|---|
| PubChem CID | 89435411 |
| Molecular Formula | C9H12N2S2 |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | 4-[(1Z,3E)-1-(methylamino)penta-1,3-dien-3-yl]-3H-1,3-thiazole-2-thione |
| SMILES | C/C=C(\C=C/NC)c1csc(=S)[nH]1 |
| InChI | InChI=1S/C9H12N2S2/c1-3-7(4-5-10-2)8-6-13-9(12)11-8/h3-6,10H,1-2H3,(H,11,12)/b5-4-,7-3+ |
| InChIKey | RUXTZGMVVUOLHV-SBYNAHCQSA-N |
| XLogP | 2.94 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|