C46H59N3O3S — CID 89435453
7-[4-[4-(3a,7a-dihydro-1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-1-[(5Z,8Z,11Z,14Z,17Z)-henicosa-5,8,11,14,17-pentaenoyl]quinolin-2-one (PubChem CID 89435453) has the molecular formula C46H59N3O3S and a molecular weight of 734.06 g/mol. Its IUPAC name is 7-[4-[4-(3a,7a-dihydro-1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-1-[(5Z,8Z,11Z,14Z,17Z)-henicosa-5,8,11,14,17-pentaenoyl]quinolin-2-one.
| Compound Name | 7-[4-[4-(3a,7a-dihydro-1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-1-[(5Z,8Z,11Z,14Z,17Z)-henicosa-5,8,11,14,17-pentaenoyl]quinolin-2-one |
|---|---|
| PubChem CID | 89435453 |
| Molecular Formula | C46H59N3O3S |
| Molecular Weight | 734.06 g/mol |
| Exact Mass | 733.43 |
| IUPAC Name | 7-[4-[4-(3a,7a-dihydro-1-benzothiophen-4-yl)piperazin-1-yl]butoxy]-1-[(5Z,8Z,11Z,14Z,17Z)-henicosa-5,8,11,14,17-pentaenoyl]quinolin-2-one |
| SMILES | CCC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)n1c(=O)ccc2ccc(OCCCCN3CCN(C4=CC=CC5SC=CC45)CC3)cc21 |
| InChI | InChI=1S/C46H59N3O3S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-25-45(50)49-43-38-40(28-26-39(43)27-29-46(49)51)52-36-21-20-31-47-32-34-48(35-33-47)42-23-22-24-44-41(42)30-37-53-44/h4-5,7-8,10-11,13-14,16-17,22-24,26-30,37-38,41,44H,2-3,6,9,12,15,18-21,25,31-36H2,1H3/b5-4-,8-7-,11-10-,14-13-,17-16- |
| InChIKey | AHOJVIFPECEVLO-JEBPEJKESA-N |
| XLogP | 10.43 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.06 |
| LogP ≤ 5 | 10.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|