C39H53N3O10 — CID 89435641
methyl (3R)-6-amino-3-[4-[6-(4-amino-4-oxobutoxy)-1-hydroxy-7-methoxy-2,8-bis(3-methylbut-2-enyl)-9-oxoxanthen-3-yl]oxybutanoylamino]hexanoate (PubChem CID 89435641) has the molecular formula C39H53N3O10 and a molecular weight of 723.86 g/mol. Its IUPAC name is methyl (3R)-6-amino-3-[4-[6-(4-amino-4-oxobutoxy)-1-hydroxy-7-methoxy-2,8-bis(3-methylbut-2-enyl)-9-oxoxanthen-3-yl]oxybutanoylamino]hexanoate.
| Compound Name | methyl (3R)-6-amino-3-[4-[6-(4-amino-4-oxobutoxy)-1-hydroxy-7-methoxy-2,8-bis(3-methylbut-2-enyl)-9-oxoxanthen-3-yl]oxybutanoylamino]hexanoate |
|---|---|
| PubChem CID | 89435641 |
| Molecular Formula | C39H53N3O10 |
| Molecular Weight | 723.86 g/mol |
| Exact Mass | 723.37 |
| IUPAC Name | methyl (3R)-6-amino-3-[4-[6-(4-amino-4-oxobutoxy)-1-hydroxy-7-methoxy-2,8-bis(3-methylbut-2-enyl)-9-oxoxanthen-3-yl]oxybutanoylamino]hexanoate |
| SMILES | COC(=O)C[C@@H](CCCN)NC(=O)CCCOc1cc2oc3cc(OCCCC(N)=O)c(OC)c(CC=C(C)C)c3c(=O)c2c(O)c1CC=C(C)C |
| InChI | InChI=1S/C39H53N3O10/c1-23(2)13-15-26-28(50-19-9-12-33(44)42-25(10-7-17-40)20-34(45)48-5)21-30-36(37(26)46)38(47)35-27(16-14-24(3)4)39(49-6)31(22-29(35)52-30)51-18-8-11-32(41)43/h13-14,21-22,25,46H,7-12,15-20,40H2,1-6H3,(H2,41,43)(H,42,44)/t25-/m1/s1 |
| InChIKey | YRXOIUZDKRYCKJ-RUZDIDTESA-N |
| XLogP | 5.27 |
| TPSA | 202.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.86 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|