C13H19N3 — CID 89435757
4-[(1E,3Z)-1-(2,4-dimethylcyclobutyl)penta-1,3-dien-2-yl]-1,2,4-triazole (PubChem CID 89435757) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is 4-[(1E,3Z)-1-(2,4-dimethylcyclobutyl)penta-1,3-dien-2-yl]-1,2,4-triazole.
| Compound Name | 4-[(1E,3Z)-1-(2,4-dimethylcyclobutyl)penta-1,3-dien-2-yl]-1,2,4-triazole |
|---|---|
| PubChem CID | 89435757 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 4-[(1E,3Z)-1-(2,4-dimethylcyclobutyl)penta-1,3-dien-2-yl]-1,2,4-triazole |
| SMILES | C/C=C\C(=C/C1C(C)CC1C)n1cnnc1 |
| InChI | InChI=1S/C13H19N3/c1-4-5-12(16-8-14-15-9-16)7-13-10(2)6-11(13)3/h4-5,7-11,13H,6H2,1-3H3/b5-4-,12-7+ |
| InChIKey | YSQIJIULBUGRSR-HCRNJAACSA-N |
| XLogP | 2.99 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|