C41H30N2O2S2 — CID 89435820
(E)-2-cyano-3-[5-[5-[1-(9,9-dimethylfluoren-2-yl)-2-phenyl-2,3-dihydroindol-5-yl]thiophen-2-yl]thiophen-2-yl]prop-2-enoic acid (PubChem CID 89435820) has the molecular formula C41H30N2O2S2 and a molecular weight of 646.84 g/mol. Its IUPAC name is (E)-2-cyano-3-[5-[5-[1-(9,9-dimethylfluoren-2-yl)-2-phenyl-2,3-dihydroindol-5-yl]thiophen-2-yl]thiophen-2-yl]prop-2-enoic acid.
| Compound Name | (E)-2-cyano-3-[5-[5-[1-(9,9-dimethylfluoren-2-yl)-2-phenyl-2,3-dihydroindol-5-yl]thiophen-2-yl]thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 89435820 |
| Molecular Formula | C41H30N2O2S2 |
| Molecular Weight | 646.84 g/mol |
| Exact Mass | 646.17 |
| IUPAC Name | (E)-2-cyano-3-[5-[5-[1-(9,9-dimethylfluoren-2-yl)-2-phenyl-2,3-dihydroindol-5-yl]thiophen-2-yl]thiophen-2-yl]prop-2-enoic acid |
| SMILES | CC1(C)c2ccccc2-c2ccc(N3c4ccc(-c5ccc(-c6ccc(/C=C(\C#N)C(=O)O)s6)s5)cc4CC3c3ccccc3)cc21 |
| InChI | InChI=1S/C41H30N2O2S2/c1-41(2)33-11-7-6-10-31(33)32-15-13-29(23-34(32)41)43-35-16-12-26(20-27(35)22-36(43)25-8-4-3-5-9-25)37-18-19-39(47-37)38-17-14-30(46-38)21-28(24-42)40(44)45/h3-21,23,36H,22H2,1-2H3,(H,44,45)/b28-21+ |
| InChIKey | ZOHLLCJVDYWWPY-SGWCAAJKSA-N |
| XLogP | 10.88 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.84 |
| LogP ≤ 5 | 10.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|