C24H21ClF2N2O4S2 — CID 89436329
3-[2-[(4S,10bS)-10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-2,4,4a,5-tetrahydro-1H-pyrano[3,4-c]chromen-4-yl]ethylsulfanyl]pyridazine (PubChem CID 89436329) has the molecular formula C24H21ClF2N2O4S2 and a molecular weight of 539.03 g/mol. Its IUPAC name is 3-[2-[(4S,10bS)-10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-2,4,4a,5-tetrahydro-1H-pyrano[3,4-c]chromen-4-yl]ethylsulfanyl]pyridazine.
| Compound Name | 3-[2-[(4S,10bS)-10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-2,4,4a,5-tetrahydro-1H-pyrano[3,4-c]chromen-4-yl]ethylsulfanyl]pyridazine |
|---|---|
| PubChem CID | 89436329 |
| Molecular Formula | C24H21ClF2N2O4S2 |
| Molecular Weight | 539.03 g/mol |
| Exact Mass | 538.06 |
| IUPAC Name | 3-[2-[(4S,10bS)-10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-2,4,4a,5-tetrahydro-1H-pyrano[3,4-c]chromen-4-yl]ethylsulfanyl]pyridazine |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)[C@@]12CCO[C@@H](CCSc3cccnn3)C1COc1c(F)ccc(F)c12 |
| InChI | InChI=1S/C24H21ClF2N2O4S2/c25-15-3-5-16(6-4-15)35(30,31)24-10-12-32-20(9-13-34-21-2-1-11-28-29-21)17(24)14-33-23-19(27)8-7-18(26)22(23)24/h1-8,11,17,20H,9-10,12-14H2/t17?,20-,24-/m0/s1 |
| InChIKey | JZCDVEDIYJKSEK-OUSZHMKWSA-N |
| XLogP | 5.06 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.03 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |