About 4-tert-butyl-2,5,6-triethylpyrimidine
4-tert-butyl-2,5,6-triethylpyrimidine (PubChem CID 89436370) has the molecular formula C14H24N2
and a molecular weight of 220.36 g/mol. Its IUPAC name is 4-tert-butyl-2,5,6-triethylpyrimidine.
Molecular Properties
| Compound Name | 4-tert-butyl-2,5,6-triethylpyrimidine |
| PubChem CID | 89436370 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | 4-tert-butyl-2,5,6-triethylpyrimidine |
| SMILES | CCc1nc(CC)c(CC)c(C(C)(C)C)n1 |
| InChI | InChI=1S/C14H24N2/c1-7-10-11(8-2)15-12(9-3)16-13(10)14(4,5)6/h7-9H2,1-6H3 |
| InChIKey | WEMQCPKVDSZNMP-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-tert-butyl-2,5,6-triethylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-2,5,6-triethylpyrimidine?
The IUPAC name of 4-tert-butyl-2,5,6-triethylpyrimidine (CID 89436370) is 4-tert-butyl-2,5,6-triethylpyrimidine.
What is the SMILES notation for 4-tert-butyl-2,5,6-triethylpyrimidine?
The canonical SMILES for 4-tert-butyl-2,5,6-triethylpyrimidine is CCc1nc(CC)c(CC)c(C(C)(C)C)n1.
What is the InChIKey of 4-tert-butyl-2,5,6-triethylpyrimidine?
The InChIKey is WEMQCPKVDSZNMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N2/c1-7-10-11(8-2)15-12(9-3)16-13(10)14(4,5)6/h7-9H2,1-6H3.
What are the key properties of 4-tert-butyl-2,5,6-triethylpyrimidine?
4-tert-butyl-2,5,6-triethylpyrimidine has a molecular weight of 220.36 g/mol, XLogP of 3.46, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-2,5,6-triethylpyrimidine is sourced from PubChem (CID 89436370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).