About 1,3-difluoroprop-1-enyl methyl carbonate
1,3-difluoroprop-1-enyl methyl carbonate (PubChem CID 89437374) has the molecular formula C5H6F2O3
and a molecular weight of 152.10 g/mol. Its IUPAC name is 1,3-difluoroprop-1-enyl methyl carbonate.
Molecular Properties
| Compound Name | 1,3-difluoroprop-1-enyl methyl carbonate |
| PubChem CID | 89437374 |
| Molecular Formula | C5H6F2O3 |
| Molecular Weight | 152.10 g/mol |
| Exact Mass | 152.03 |
| IUPAC Name | 1,3-difluoroprop-1-enyl methyl carbonate |
| SMILES | COC(=O)OC(F)=CCF |
| InChI | InChI=1S/C5H6F2O3/c1-9-5(8)10-4(7)2-3-6/h2H,3H2,1H3 |
| InChIKey | UCAIIDYTPKHSRB-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.10 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1,3-difluoroprop-1-enyl methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-difluoroprop-1-enyl methyl carbonate?
The IUPAC name of 1,3-difluoroprop-1-enyl methyl carbonate (CID 89437374) is 1,3-difluoroprop-1-enyl methyl carbonate.
What is the SMILES notation for 1,3-difluoroprop-1-enyl methyl carbonate?
The canonical SMILES for 1,3-difluoroprop-1-enyl methyl carbonate is COC(=O)OC(F)=CCF.
What is the InChIKey of 1,3-difluoroprop-1-enyl methyl carbonate?
The InChIKey is UCAIIDYTPKHSRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6F2O3/c1-9-5(8)10-4(7)2-3-6/h2H,3H2,1H3.
What are the key properties of 1,3-difluoroprop-1-enyl methyl carbonate?
1,3-difluoroprop-1-enyl methyl carbonate has a molecular weight of 152.10 g/mol, XLogP of 1.55, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-difluoroprop-1-enyl methyl carbonate is sourced from PubChem (CID 89437374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).