C36H38F5NO3 — CID 89438114
4-[(11R,13S,17R)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]-N-methyl-N-(2-phenylethyl)benzamide (PubChem CID 89438114) has the molecular formula C36H38F5NO3 and a molecular weight of 627.69 g/mol. Its IUPAC name is 4-[(11R,13S,17R)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]-N-methyl-N-(2-phenylethyl)benzamide.
| Compound Name | 4-[(11R,13S,17R)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]-N-methyl-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 89438114 |
| Molecular Formula | C36H38F5NO3 |
| Molecular Weight | 627.69 g/mol |
| Exact Mass | 627.28 |
| IUPAC Name | 4-[(11R,13S,17R)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]-N-methyl-N-(2-phenylethyl)benzamide |
| SMILES | CN(CCc1ccccc1)C(=O)c1ccc([C@H]2C[C@@]3(C)C(CC[C@]3(O)C(F)(F)C(F)(F)F)C3CCC4=CC(=O)CCC4=C32)cc1 |
| InChI | InChI=1S/C36H38F5NO3/c1-33-21-29(23-8-10-24(11-9-23)32(44)42(2)19-17-22-6-4-3-5-7-22)31-27-15-13-26(43)20-25(27)12-14-28(31)30(33)16-18-34(33,45)35(37,38)36(39,40)41/h3-11,20,28-30,45H,12-19,21H2,1-2H3/t28?,29-,30?,33+,34-/m1/s1 |
| InChIKey | AKNRJDSWVIWVLO-BCGXQBORSA-N |
| XLogP | 7.83 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.69 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|