C34H34F5NO4 — CID 89438119
4-[(11R,13S,17R)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]-N-(2-methoxyphenyl)benzamide (PubChem CID 89438119) has the molecular formula C34H34F5NO4 and a molecular weight of 615.64 g/mol. Its IUPAC name is 4-[(11R,13S,17R)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]-N-(2-methoxyphenyl)benzamide.
| Compound Name | 4-[(11R,13S,17R)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]-N-(2-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 89438119 |
| Molecular Formula | C34H34F5NO4 |
| Molecular Weight | 615.64 g/mol |
| Exact Mass | 615.24 |
| IUPAC Name | 4-[(11R,13S,17R)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]-N-(2-methoxyphenyl)benzamide |
| SMILES | COc1ccccc1NC(=O)c1ccc([C@H]2C[C@@]3(C)C(CC[C@]3(O)C(F)(F)C(F)(F)F)C3CCC4=CC(=O)CCC4=C32)cc1 |
| InChI | InChI=1S/C34H34F5NO4/c1-31-18-25(19-7-9-20(10-8-19)30(42)40-27-5-3-4-6-28(27)44-2)29-23-14-12-22(41)17-21(23)11-13-24(29)26(31)15-16-32(31,43)33(35,36)34(37,38)39/h3-10,17,24-26,43H,11-16,18H2,1-2H3,(H,40,42)/t24?,25-,26?,31+,32-/m1/s1 |
| InChIKey | AZWZTQIHSPFDNJ-FDWCXCPNSA-N |
| XLogP | 7.78 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.64 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|