C21H16ClF5N8OS — CID 89438346
4-amino-2-[5-chloro-3-(3,3,4,4,4-pentafluorobutyl)indazol-1-yl]-5-methyl-5-(5-methyl-1,3,4-thiadiazol-2-yl)-7H-pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 89438346) has the molecular formula C21H16ClF5N8OS and a molecular weight of 558.92 g/mol. Its IUPAC name is 4-amino-2-[5-chloro-3-(3,3,4,4,4-pentafluorobutyl)indazol-1-yl]-5-methyl-5-(5-methyl-1,3,4-thiadiazol-2-yl)-7H-pyrrolo[2,3-d]pyrimidin-6-one.
| Compound Name | 4-amino-2-[5-chloro-3-(3,3,4,4,4-pentafluorobutyl)indazol-1-yl]-5-methyl-5-(5-methyl-1,3,4-thiadiazol-2-yl)-7H-pyrrolo[2,3-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 89438346 |
| Molecular Formula | C21H16ClF5N8OS |
| Molecular Weight | 558.92 g/mol |
| Exact Mass | 558.08 |
| IUPAC Name | 4-amino-2-[5-chloro-3-(3,3,4,4,4-pentafluorobutyl)indazol-1-yl]-5-methyl-5-(5-methyl-1,3,4-thiadiazol-2-yl)-7H-pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | Cc1nnc(C2(C)C(=O)Nc3nc(-n4nc(CCC(F)(F)C(F)(F)F)c5cc(Cl)ccc54)nc(N)c32)s1 |
| InChI | InChI=1S/C21H16ClF5N8OS/c1-8-32-33-17(37-8)19(2)13-14(28)29-18(31-15(13)30-16(19)36)35-12-4-3-9(22)7-10(12)11(34-35)5-6-20(23,24)21(25,26)27/h3-4,7H,5-6H2,1-2H3,(H3,28,29,30,31,36) |
| InChIKey | IMSVNCBSKWXRRX-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 124.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.92 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|