C16H11Cl4N2O2+ — CID 89438435
1,3-bis(2,6-dichlorophenyl)-4,5-dihydroimidazol-1-ium-2-carboxylic acid (PubChem CID 89438435) has the molecular formula C16H11Cl4N2O2+ and a molecular weight of 405.09 g/mol. Its IUPAC name is 1,3-bis(2,6-dichlorophenyl)-4,5-dihydroimidazol-1-ium-2-carboxylic acid.
| Compound Name | 1,3-bis(2,6-dichlorophenyl)-4,5-dihydroimidazol-1-ium-2-carboxylic acid |
|---|---|
| PubChem CID | 89438435 |
| Molecular Formula | C16H11Cl4N2O2+ |
| Molecular Weight | 405.09 g/mol |
| Exact Mass | 402.96 |
| IUPAC Name | 1,3-bis(2,6-dichlorophenyl)-4,5-dihydroimidazol-1-ium-2-carboxylic acid |
| SMILES | O=C(O)C1=[N+](c2c(Cl)cccc2Cl)CCN1c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C16H10Cl4N2O2/c17-9-3-1-4-10(18)13(9)21-7-8-22(15(21)16(23)24)14-11(19)5-2-6-12(14)20/h1-6H,7-8H2/p+1 |
| InChIKey | HYXASSJZLMKELS-UHFFFAOYSA-O |
| XLogP | 4.95 |
| TPSA | 43.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.09 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|