C20H17F6N7O2 — CID 89438464
4-amino-2-[5-fluoro-3-(3,3,4,4,4-pentafluorobutyl)indazol-1-yl]-N,5-dimethyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidine-5-carboxamide (PubChem CID 89438464) has the molecular formula C20H17F6N7O2 and a molecular weight of 501.39 g/mol. Its IUPAC name is 4-amino-2-[5-fluoro-3-(3,3,4,4,4-pentafluorobutyl)indazol-1-yl]-N,5-dimethyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | 4-amino-2-[5-fluoro-3-(3,3,4,4,4-pentafluorobutyl)indazol-1-yl]-N,5-dimethyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 89438464 |
| Molecular Formula | C20H17F6N7O2 |
| Molecular Weight | 501.39 g/mol |
| Exact Mass | 501.13 |
| IUPAC Name | 4-amino-2-[5-fluoro-3-(3,3,4,4,4-pentafluorobutyl)indazol-1-yl]-N,5-dimethyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidine-5-carboxamide |
| SMILES | CNC(=O)C1(C)C(=O)Nc2nc(-n3nc(CCC(F)(F)C(F)(F)F)c4cc(F)ccc43)nc(N)c21 |
| InChI | InChI=1S/C20H17F6N7O2/c1-18(15(34)28-2)12-13(27)29-17(31-14(12)30-16(18)35)33-11-4-3-8(21)7-9(11)10(32-33)5-6-19(22,23)20(24,25)26/h3-4,7H,5-6H2,1-2H3,(H,28,34)(H3,27,29,30,31,35) |
| InChIKey | OOGCZDYNCXBSDM-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 127.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.39 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|