C24H25F5N8O3 — CID 89438518
4-amino-5-methyl-2-[6-methyl-1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridin-3-yl]-N-(oxan-4-yl)-6-oxo-7H-pyrrolo[2,3-d]pyrimidine-5-carboxamide (PubChem CID 89438518) has the molecular formula C24H25F5N8O3 and a molecular weight of 568.51 g/mol. Its IUPAC name is 4-amino-5-methyl-2-[6-methyl-1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridin-3-yl]-N-(oxan-4-yl)-6-oxo-7H-pyrrolo[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | 4-amino-5-methyl-2-[6-methyl-1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridin-3-yl]-N-(oxan-4-yl)-6-oxo-7H-pyrrolo[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 89438518 |
| Molecular Formula | C24H25F5N8O3 |
| Molecular Weight | 568.51 g/mol |
| Exact Mass | 568.20 |
| IUPAC Name | 4-amino-5-methyl-2-[6-methyl-1-(3,3,4,4,4-pentafluorobutyl)pyrazolo[5,4-b]pyridin-3-yl]-N-(oxan-4-yl)-6-oxo-7H-pyrrolo[2,3-d]pyrimidine-5-carboxamide |
| SMILES | Cc1ccc2c(-c3nc(N)c4c(n3)NC(=O)C4(C)C(=O)NC3CCOCC3)nn(CCC(F)(F)C(F)(F)F)c2n1 |
| InChI | InChI=1S/C24H25F5N8O3/c1-11-3-4-13-15(36-37(19(13)31-11)8-7-23(25,26)24(27,28)29)18-33-16(30)14-17(34-18)35-21(39)22(14,2)20(38)32-12-5-9-40-10-6-12/h3-4,12H,5-10H2,1-2H3,(H,32,38)(H3,30,33,34,35,39) |
| InChIKey | PJYSCXKYNKQSIZ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 149.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.51 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|