About 1-Cyclohexyl-3-[2,6-di(propan-2-yl)phenyl]imidazol-1-ium
1-Cyclohexyl-3-[2,6-di(propan-2-yl)phenyl]imidazol-1-ium (PubChem CID 89438571) has the molecular formula C21H31N2+
and a molecular weight of 311.50 g/mol. Its IUPAC name is 1-cyclohexyl-3-[2,6-di(propan-2-yl)phenyl]imidazol-1-ium.
Molecular Properties
| Compound Name | 1-Cyclohexyl-3-[2,6-di(propan-2-yl)phenyl]imidazol-1-ium |
| PubChem CID | 89438571 |
| Molecular Formula | C21H31N2+ |
| Molecular Weight | 311.50 g/mol |
| Exact Mass | 311.25 |
| IUPAC Name | 1-cyclohexyl-3-[2,6-di(propan-2-yl)phenyl]imidazol-1-ium |
| SMILES | CC(C)C1=C(C(=CC=C1)C(C)C)N2C=C[N+](=C2)C3CCCCC3 |
| InChI | InChI=1S/C21H31N2/c1-16(2)19-11-8-12-20(17(3)4)21(19)23-14-13-22(15-23)18-9-6-5-7-10-18/h8,11-18H,5-7,9-10H2,1-4H3/q+1 |
| InChIKey | UEMGLHDWTDMPFF-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 8.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | 343 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 311.50 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-Cyclohexyl-3-[2,6-di(propan-2-yl)phenyl]imidazol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-Cyclohexyl-3-[2,6-di(propan-2-yl)phenyl]imidazol-1-ium?
The IUPAC name of 1-Cyclohexyl-3-[2,6-di(propan-2-yl)phenyl]imidazol-1-ium (CID 89438571) is 1-cyclohexyl-3-[2,6-di(propan-2-yl)phenyl]imidazol-1-ium.
What is the SMILES notation for 1-Cyclohexyl-3-[2,6-di(propan-2-yl)phenyl]imidazol-1-ium?
The canonical SMILES for 1-Cyclohexyl-3-[2,6-di(propan-2-yl)phenyl]imidazol-1-ium is CC(C)C1=C(C(=CC=C1)C(C)C)N2C=C[N+](=C2)C3CCCCC3.
What is the InChIKey of 1-Cyclohexyl-3-[2,6-di(propan-2-yl)phenyl]imidazol-1-ium?
The InChIKey is UEMGLHDWTDMPFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H31N2/c1-16(2)19-11-8-12-20(17(3)4)21(19)23-14-13-22(15-23)18-9-6-5-7-10-18/h8,11-18H,5-7,9-10H2,1-4H3/q+1.
What are the key properties of 1-Cyclohexyl-3-[2,6-di(propan-2-yl)phenyl]imidazol-1-ium?
1-Cyclohexyl-3-[2,6-di(propan-2-yl)phenyl]imidazol-1-ium has a molecular weight of 311.50 g/mol, XLogP of 5.80, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-Cyclohexyl-3-[2,6-di(propan-2-yl)phenyl]imidazol-1-ium is sourced from PubChem (CID 89438571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).