C23H19F3N4O3S — CID 89438910
[3-[[6-[4-(pyrrolidin-1-ylmethyl)furan-2-yl]thieno[3,2-d]pyrimidin-4-yl]amino]phenyl] 2,2,2-trifluoroacetate (PubChem CID 89438910) has the molecular formula C23H19F3N4O3S and a molecular weight of 488.49 g/mol. Its IUPAC name is [3-[[6-[4-(pyrrolidin-1-ylmethyl)furan-2-yl]thieno[3,2-d]pyrimidin-4-yl]amino]phenyl] 2,2,2-trifluoroacetate.
| Compound Name | [3-[[6-[4-(pyrrolidin-1-ylmethyl)furan-2-yl]thieno[3,2-d]pyrimidin-4-yl]amino]phenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 89438910 |
| Molecular Formula | C23H19F3N4O3S |
| Molecular Weight | 488.49 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | [3-[[6-[4-(pyrrolidin-1-ylmethyl)furan-2-yl]thieno[3,2-d]pyrimidin-4-yl]amino]phenyl] 2,2,2-trifluoroacetate |
| SMILES | O=C(Oc1cccc(Nc2ncnc3cc(-c4cc(CN5CCCC5)co4)sc23)c1)C(F)(F)F |
| InChI | InChI=1S/C23H19F3N4O3S/c24-23(25,26)22(31)33-16-5-3-4-15(9-16)29-21-20-17(27-13-28-21)10-19(34-20)18-8-14(12-32-18)11-30-6-1-2-7-30/h3-5,8-10,12-13H,1-2,6-7,11H2,(H,27,28,29) |
| InChIKey | QMXYJCGFNOCSIF-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.49 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|