C21H24F3N3O4S3 — CID 89438926
N-[3-(1,3-benzothiazol-2-yl)-6,6-diethyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-ium-2-yl]acetamide;trifluoromethanesulfonate (PubChem CID 89438926) has the molecular formula C21H24F3N3O4S3 and a molecular weight of 535.64 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)-6,6-diethyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-ium-2-yl]acetamide;trifluoromethanesulfonate.
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)-6,6-diethyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-ium-2-yl]acetamide;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 89438926 |
| Molecular Formula | C21H24F3N3O4S3 |
| Molecular Weight | 535.64 g/mol |
| Exact Mass | 535.09 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)-6,6-diethyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-ium-2-yl]acetamide;trifluoromethanesulfonate |
| SMILES | CC[N+]1(CC)CCc2c(sc(NC(C)=O)c2-c2nc3ccccc3s2)C1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C20H23N3OS2.CHF3O3S/c1-4-23(5-2)11-10-14-17(12-23)26-19(21-13(3)24)18(14)20-22-15-8-6-7-9-16(15)25-20;2-1(3,4)8(5,6)7/h6-9H,4-5,10-12H2,1-3H3;(H,5,6,7) |
| InChIKey | KFPQXJNGGDLLKN-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 99.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.64 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|