C32H24F3N5O4 — CID 89439009
4-[4-(2-oxo-9-quinolin-3-yl-4H-[1,3]oxazino[5,4-c]quinolin-1-yl)-2-(trifluoromethyl)phenyl]piperazine-1-carboxylic acid (PubChem CID 89439009) has the molecular formula C32H24F3N5O4 and a molecular weight of 599.57 g/mol. Its IUPAC name is 4-[4-(2-oxo-9-quinolin-3-yl-4H-[1,3]oxazino[5,4-c]quinolin-1-yl)-2-(trifluoromethyl)phenyl]piperazine-1-carboxylic acid.
| Compound Name | 4-[4-(2-oxo-9-quinolin-3-yl-4H-[1,3]oxazino[5,4-c]quinolin-1-yl)-2-(trifluoromethyl)phenyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 89439009 |
| Molecular Formula | C32H24F3N5O4 |
| Molecular Weight | 599.57 g/mol |
| Exact Mass | 599.18 |
| IUPAC Name | 4-[4-(2-oxo-9-quinolin-3-yl-4H-[1,3]oxazino[5,4-c]quinolin-1-yl)-2-(trifluoromethyl)phenyl]piperazine-1-carboxylic acid |
| SMILES | O=C(O)N1CCN(c2ccc(N3C(=O)OCc4cnc5ccc(-c6cnc7ccccc7c6)cc5c43)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C32H24F3N5O4/c33-32(34,35)25-15-23(6-8-28(25)38-9-11-39(12-10-38)30(41)42)40-29-22(18-44-31(40)43)17-37-27-7-5-19(14-24(27)29)21-13-20-3-1-2-4-26(20)36-16-21/h1-8,13-17H,9-12,18H2,(H,41,42) |
| InChIKey | PENPBFXFDLDTHZ-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.57 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|