About 3,3-dimethylbutan-2-yl ethanesulfonate
3,3-dimethylbutan-2-yl ethanesulfonate (PubChem CID 89439035) has the molecular formula C8H18O3S
and a molecular weight of 194.30 g/mol. Its IUPAC name is 3,3-dimethylbutan-2-yl ethanesulfonate.
Molecular Properties
| Compound Name | 3,3-dimethylbutan-2-yl ethanesulfonate |
| PubChem CID | 89439035 |
| Molecular Formula | C8H18O3S |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.10 |
| IUPAC Name | 3,3-dimethylbutan-2-yl ethanesulfonate |
| SMILES | CCS(=O)(=O)OC(C)C(C)(C)C |
| InChI | InChI=1S/C8H18O3S/c1-6-12(9,10)11-7(2)8(3,4)5/h7H,6H2,1-5H3 |
| InChIKey | RNOGHIMSKVGVBA-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 3,3-dimethylbutan-2-yl ethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethylbutan-2-yl ethanesulfonate?
The IUPAC name of 3,3-dimethylbutan-2-yl ethanesulfonate (CID 89439035) is 3,3-dimethylbutan-2-yl ethanesulfonate.
What is the SMILES notation for 3,3-dimethylbutan-2-yl ethanesulfonate?
The canonical SMILES for 3,3-dimethylbutan-2-yl ethanesulfonate is CCS(=O)(=O)OC(C)C(C)(C)C.
What is the InChIKey of 3,3-dimethylbutan-2-yl ethanesulfonate?
The InChIKey is RNOGHIMSKVGVBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O3S/c1-6-12(9,10)11-7(2)8(3,4)5/h7H,6H2,1-5H3.
What are the key properties of 3,3-dimethylbutan-2-yl ethanesulfonate?
3,3-dimethylbutan-2-yl ethanesulfonate has a molecular weight of 194.30 g/mol, XLogP of 1.79, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethylbutan-2-yl ethanesulfonate is sourced from PubChem (CID 89439035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).