About (3-ethylsulfonyloxy-4,4-dimethylhexan-2-yl) ethanesulfonate
(3-ethylsulfonyloxy-4,4-dimethylhexan-2-yl) ethanesulfonate (PubChem CID 89439101) has the molecular formula C12H26O6S2
and a molecular weight of 330.47 g/mol. Its IUPAC name is (3-ethylsulfonyloxy-4,4-dimethylhexan-2-yl) ethanesulfonate.
Molecular Properties
| Compound Name | (3-ethylsulfonyloxy-4,4-dimethylhexan-2-yl) ethanesulfonate |
| PubChem CID | 89439101 |
| Molecular Formula | C12H26O6S2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | (3-ethylsulfonyloxy-4,4-dimethylhexan-2-yl) ethanesulfonate |
| SMILES | CCC(C)(C)C(OS(=O)(=O)CC)C(C)OS(=O)(=O)CC |
| InChI | InChI=1S/C12H26O6S2/c1-7-12(5,6)11(18-20(15,16)9-3)10(4)17-19(13,14)8-2/h10-11H,7-9H2,1-6H3 |
| InChIKey | IBALDZZWYWDBGW-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (3-ethylsulfonyloxy-4,4-dimethylhexan-2-yl) ethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-ethylsulfonyloxy-4,4-dimethylhexan-2-yl) ethanesulfonate?
The IUPAC name of (3-ethylsulfonyloxy-4,4-dimethylhexan-2-yl) ethanesulfonate (CID 89439101) is (3-ethylsulfonyloxy-4,4-dimethylhexan-2-yl) ethanesulfonate.
What is the SMILES notation for (3-ethylsulfonyloxy-4,4-dimethylhexan-2-yl) ethanesulfonate?
The canonical SMILES for (3-ethylsulfonyloxy-4,4-dimethylhexan-2-yl) ethanesulfonate is CCC(C)(C)C(OS(=O)(=O)CC)C(C)OS(=O)(=O)CC.
What is the InChIKey of (3-ethylsulfonyloxy-4,4-dimethylhexan-2-yl) ethanesulfonate?
The InChIKey is IBALDZZWYWDBGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26O6S2/c1-7-12(5,6)11(18-20(15,16)9-3)10(4)17-19(13,14)8-2/h10-11H,7-9H2,1-6H3.
What are the key properties of (3-ethylsulfonyloxy-4,4-dimethylhexan-2-yl) ethanesulfonate?
(3-ethylsulfonyloxy-4,4-dimethylhexan-2-yl) ethanesulfonate has a molecular weight of 330.47 g/mol, XLogP of 1.91, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-ethylsulfonyloxy-4,4-dimethylhexan-2-yl) ethanesulfonate is sourced from PubChem (CID 89439101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).