About 2-phenyl-2-propan-2-yl-1,3-dioxane
2-phenyl-2-propan-2-yl-1,3-dioxane (PubChem CID 89439443) has the molecular formula C13H18O2
and a molecular weight of 206.29 g/mol. Its IUPAC name is 2-phenyl-2-propan-2-yl-1,3-dioxane.
Molecular Properties
| Compound Name | 2-phenyl-2-propan-2-yl-1,3-dioxane |
| PubChem CID | 89439443 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 2-phenyl-2-propan-2-yl-1,3-dioxane |
| SMILES | CC(C)C1(c2ccccc2)OCCCO1 |
| InChI | InChI=1S/C13H18O2/c1-11(2)13(14-9-6-10-15-13)12-7-4-3-5-8-12/h3-5,7-8,11H,6,9-10H2,1-2H3 |
| InChIKey | SLUOOQFBKOLMKE-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-phenyl-2-propan-2-yl-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-2-propan-2-yl-1,3-dioxane?
The IUPAC name of 2-phenyl-2-propan-2-yl-1,3-dioxane (CID 89439443) is 2-phenyl-2-propan-2-yl-1,3-dioxane.
What is the SMILES notation for 2-phenyl-2-propan-2-yl-1,3-dioxane?
The canonical SMILES for 2-phenyl-2-propan-2-yl-1,3-dioxane is CC(C)C1(c2ccccc2)OCCCO1.
What is the InChIKey of 2-phenyl-2-propan-2-yl-1,3-dioxane?
The InChIKey is SLUOOQFBKOLMKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O2/c1-11(2)13(14-9-6-10-15-13)12-7-4-3-5-8-12/h3-5,7-8,11H,6,9-10H2,1-2H3.
What are the key properties of 2-phenyl-2-propan-2-yl-1,3-dioxane?
2-phenyl-2-propan-2-yl-1,3-dioxane has a molecular weight of 206.29 g/mol, XLogP of 2.93, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-2-propan-2-yl-1,3-dioxane is sourced from PubChem (CID 89439443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).