C23H35NO7 — CID 89440988
[(3R,4S,5S,6R)-5-methoxy-4-[(3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-(4-oxohexanoyl)carbamate (PubChem CID 89440988) has the molecular formula C23H35NO7 and a molecular weight of 437.53 g/mol. Its IUPAC name is [(3R,4S,5S,6R)-5-methoxy-4-[(3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-(4-oxohexanoyl)carbamate.
| Compound Name | [(3R,4S,5S,6R)-5-methoxy-4-[(3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-(4-oxohexanoyl)carbamate |
|---|---|
| PubChem CID | 89440988 |
| Molecular Formula | C23H35NO7 |
| Molecular Weight | 437.53 g/mol |
| Exact Mass | 437.24 |
| IUPAC Name | [(3R,4S,5S,6R)-5-methoxy-4-[(3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-(4-oxohexanoyl)carbamate |
| SMILES | CCC(=O)CCC(=O)NC(=O)O[C@@H]1CC[C@]2(CO2)[C@@H](C2(C)O[C@@H]2CC=C(C)C)[C@@H]1OC |
| InChI | InChI=1S/C23H35NO7/c1-6-15(25)8-10-18(26)24-21(27)30-16-11-12-23(13-29-23)20(19(16)28-5)22(4)17(31-22)9-7-14(2)3/h7,16-17,19-20H,6,8-13H2,1-5H3,(H,24,26,27)/t16-,17-,19-,20-,22?,23+/m1/s1 |
| InChIKey | ZHYUOADBJDBCJH-OBGJZLKLSA-N |
| XLogP | 3.07 |
| TPSA | 106.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.53 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|