About N-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-4-methylsulfonylbenzamide
N-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-4-methylsulfonylbenzamide (PubChem CID 8944101) has the molecular formula C21H23N3O3S
and a molecular weight of 397.50 g/mol. Its IUPAC name is N-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-4-methylsulfonylbenzamide.
Molecular Properties
| Compound Name | N-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-4-methylsulfonylbenzamide |
| PubChem CID | 8944101 |
| Molecular Formula | C21H23N3O3S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | N-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-4-methylsulfonylbenzamide |
| SMILES | Cc1nn(Cc2ccccc2)c(C)c1CNC(=O)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C21H23N3O3S/c1-15-20(16(2)24(23-15)14-17-7-5-4-6-8-17)13-22-21(25)18-9-11-19(12-10-18)28(3,26)27/h4-12H,13-14H2,1-3H3,(H,22,25) |
| InChIKey | RRSLFCLQCGRIQI-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-4-methylsulfonylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-4-methylsulfonylbenzamide?
The IUPAC name of N-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-4-methylsulfonylbenzamide (CID 8944101) is N-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-4-methylsulfonylbenzamide.
What is the SMILES notation for N-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-4-methylsulfonylbenzamide?
The canonical SMILES for N-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-4-methylsulfonylbenzamide is Cc1nn(Cc2ccccc2)c(C)c1CNC(=O)c1ccc(S(C)(=O)=O)cc1.
What is the InChIKey of N-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-4-methylsulfonylbenzamide?
The InChIKey is RRSLFCLQCGRIQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23N3O3S/c1-15-20(16(2)24(23-15)14-17-7-5-4-6-8-17)13-22-21(25)18-9-11-19(12-10-18)28(3,26)27/h4-12H,13-14H2,1-3H3,(H,22,25).
What are the key properties of N-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-4-methylsulfonylbenzamide?
N-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-4-methylsulfonylbenzamide has a molecular weight of 397.50 g/mol, XLogP of 2.88, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-4-methylsulfonylbenzamide is sourced from PubChem (CID 8944101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).