C18H19F13O5 — CID 89441101
1-[3-[2,3-bis(prop-2-enoxy)propoxy]-1,1,1,2-tetrafluoropropan-2-yl]oxy-1,1,2,3,3,3-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)propane (PubChem CID 89441101) has the molecular formula C18H19F13O5 and a molecular weight of 562.32 g/mol. Its IUPAC name is 1-[3-[2,3-bis(prop-2-enoxy)propoxy]-1,1,1,2-tetrafluoropropan-2-yl]oxy-1,1,2,3,3,3-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)propane.
| Compound Name | 1-[3-[2,3-bis(prop-2-enoxy)propoxy]-1,1,1,2-tetrafluoropropan-2-yl]oxy-1,1,2,3,3,3-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)propane |
|---|---|
| PubChem CID | 89441101 |
| Molecular Formula | C18H19F13O5 |
| Molecular Weight | 562.32 g/mol |
| Exact Mass | 562.10 |
| IUPAC Name | 1-[3-[2,3-bis(prop-2-enoxy)propoxy]-1,1,1,2-tetrafluoropropan-2-yl]oxy-1,1,2,3,3,3-hexafluoro-2-(1,1,2-trifluoroprop-2-enoxy)propane |
| SMILES | C=CCOCC(COCC(F)(OC(F)(F)C(F)(OC(F)(F)C(=C)F)C(F)(F)F)C(F)(F)F)OCC=C |
| InChI | InChI=1S/C18H19F13O5/c1-4-6-32-8-12(34-7-5-2)9-33-10-13(20,16(24,25)26)35-18(30,31)15(23,17(27,28)29)36-14(21,22)11(3)19/h4-5,12H,1-3,6-10H2 |
| InChIKey | IRIJHCGIOTXJNV-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.32 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|