C12H9F13O3 — CID 89441103
1,1,1,2,3,3-hexafluoro-3-(1,1,1,2-tetrafluoro-3-prop-2-enoxypropan-2-yl)oxy-2-(1,1,2-trifluoroprop-2-enoxy)propane (PubChem CID 89441103) has the molecular formula C12H9F13O3 and a molecular weight of 448.18 g/mol. Its IUPAC name is 1,1,1,2,3,3-hexafluoro-3-(1,1,1,2-tetrafluoro-3-prop-2-enoxypropan-2-yl)oxy-2-(1,1,2-trifluoroprop-2-enoxy)propane.
| Compound Name | 1,1,1,2,3,3-hexafluoro-3-(1,1,1,2-tetrafluoro-3-prop-2-enoxypropan-2-yl)oxy-2-(1,1,2-trifluoroprop-2-enoxy)propane |
|---|---|
| PubChem CID | 89441103 |
| Molecular Formula | C12H9F13O3 |
| Molecular Weight | 448.18 g/mol |
| Exact Mass | 448.03 |
| IUPAC Name | 1,1,1,2,3,3-hexafluoro-3-(1,1,1,2-tetrafluoro-3-prop-2-enoxypropan-2-yl)oxy-2-(1,1,2-trifluoroprop-2-enoxy)propane |
| SMILES | C=CCOCC(F)(OC(F)(F)C(F)(OC(F)(F)C(=C)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H9F13O3/c1-3-4-26-5-7(14,10(18,19)20)27-12(24,25)9(17,11(21,22)23)28-8(15,16)6(2)13/h3H,1-2,4-5H2 |
| InChIKey | WMYSAKIBJZZKBY-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.18 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|