C6H4F8O — CID 89441122
1,1,2,3,3-pentafluoro-3-(1,1,2-trifluoropropoxy)prop-1-ene (PubChem CID 89441122) has the molecular formula C6H4F8O and a molecular weight of 244.08 g/mol. Its IUPAC name is 1,1,2,3,3-pentafluoro-3-(1,1,2-trifluoropropoxy)prop-1-ene.
| Compound Name | 1,1,2,3,3-pentafluoro-3-(1,1,2-trifluoropropoxy)prop-1-ene |
|---|---|
| PubChem CID | 89441122 |
| Molecular Formula | C6H4F8O |
| Molecular Weight | 244.08 g/mol |
| Exact Mass | 244.01 |
| IUPAC Name | 1,1,2,3,3-pentafluoro-3-(1,1,2-trifluoropropoxy)prop-1-ene |
| SMILES | CC(F)C(F)(F)OC(F)(F)C(F)=C(F)F |
| InChI | InChI=1S/C6H4F8O/c1-2(7)5(11,12)15-6(13,14)3(8)4(9)10/h2H,1H3 |
| InChIKey | XNNVDEHNDSJQSQ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.08 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |