About 1-(C,N-dimethylcarbonimidoyl)-5-fluoropyridin-2-imine
1-(C,N-dimethylcarbonimidoyl)-5-fluoropyridin-2-imine (PubChem CID 89441546) has the molecular formula C8H10FN3
and a molecular weight of 167.19 g/mol. Its IUPAC name is 1-(C,N-dimethylcarbonimidoyl)-5-fluoropyridin-2-imine.
Molecular Properties
| Compound Name | 1-(C,N-dimethylcarbonimidoyl)-5-fluoropyridin-2-imine |
| PubChem CID | 89441546 |
| Molecular Formula | C8H10FN3 |
| Molecular Weight | 167.19 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | 1-(C,N-dimethylcarbonimidoyl)-5-fluoropyridin-2-imine |
| SMILES | [H]/N=c1\ccc(F)cn1/C(C)=N/C |
| InChI | InChI=1S/C8H10FN3/c1-6(11-2)12-5-7(9)3-4-8(12)10/h3-5,10H,1-2H3/b10-8+,11-6+ |
| InChIKey | TVSVHHIGDACKHJ-UGHCYFJLSA-N |
| XLogP | 1.00 |
| TPSA | 41.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.19 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(C,N-dimethylcarbonimidoyl)-5-fluoropyridin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(C,N-dimethylcarbonimidoyl)-5-fluoropyridin-2-imine?
The IUPAC name of 1-(C,N-dimethylcarbonimidoyl)-5-fluoropyridin-2-imine (CID 89441546) is 1-(C,N-dimethylcarbonimidoyl)-5-fluoropyridin-2-imine.
What is the SMILES notation for 1-(C,N-dimethylcarbonimidoyl)-5-fluoropyridin-2-imine?
The canonical SMILES for 1-(C,N-dimethylcarbonimidoyl)-5-fluoropyridin-2-imine is [H]/N=c1\ccc(F)cn1/C(C)=N/C.
What is the InChIKey of 1-(C,N-dimethylcarbonimidoyl)-5-fluoropyridin-2-imine?
The InChIKey is TVSVHHIGDACKHJ-UGHCYFJLSA-N. The full InChI is InChI=1S/C8H10FN3/c1-6(11-2)12-5-7(9)3-4-8(12)10/h3-5,10H,1-2H3/b10-8+,11-6+.
What are the key properties of 1-(C,N-dimethylcarbonimidoyl)-5-fluoropyridin-2-imine?
1-(C,N-dimethylcarbonimidoyl)-5-fluoropyridin-2-imine has a molecular weight of 167.19 g/mol, XLogP of 1.00, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(C,N-dimethylcarbonimidoyl)-5-fluoropyridin-2-imine is sourced from PubChem (CID 89441546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).