About 3-ethynyl-2-methyl-2,5-dihydrothiophene
3-ethynyl-2-methyl-2,5-dihydrothiophene (PubChem CID 89441619) has the molecular formula C7H8S
and a molecular weight of 124.21 g/mol. Its IUPAC name is 3-ethynyl-2-methyl-2,5-dihydrothiophene.
Molecular Properties
| Compound Name | 3-ethynyl-2-methyl-2,5-dihydrothiophene |
| PubChem CID | 89441619 |
| Molecular Formula | C7H8S |
| Molecular Weight | 124.21 g/mol |
| Exact Mass | 124.03 |
| IUPAC Name | 3-ethynyl-2-methyl-2,5-dihydrothiophene |
| SMILES | C#CC1=CCSC1C |
| InChI | InChI=1S/C7H8S/c1-3-7-4-5-8-6(7)2/h1,4,6H,5H2,2H3 |
| InChIKey | ZBLBJIVEEMOMDG-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.21 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-ethynyl-2-methyl-2,5-dihydrothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethynyl-2-methyl-2,5-dihydrothiophene?
The IUPAC name of 3-ethynyl-2-methyl-2,5-dihydrothiophene (CID 89441619) is 3-ethynyl-2-methyl-2,5-dihydrothiophene.
What is the SMILES notation for 3-ethynyl-2-methyl-2,5-dihydrothiophene?
The canonical SMILES for 3-ethynyl-2-methyl-2,5-dihydrothiophene is C#CC1=CCSC1C.
What is the InChIKey of 3-ethynyl-2-methyl-2,5-dihydrothiophene?
The InChIKey is ZBLBJIVEEMOMDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8S/c1-3-7-4-5-8-6(7)2/h1,4,6H,5H2,2H3.
What are the key properties of 3-ethynyl-2-methyl-2,5-dihydrothiophene?
3-ethynyl-2-methyl-2,5-dihydrothiophene has a molecular weight of 124.21 g/mol, XLogP of 1.68, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethynyl-2-methyl-2,5-dihydrothiophene is sourced from PubChem (CID 89441619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).