C15H20N2 — CID 89441651
(2E,4E)-N,N-dimethyl-3-[(6-methylidenecyclohexa-2,4-dien-1-ylidene)amino]hexa-2,4-dien-2-amine (PubChem CID 89441651) has the molecular formula C15H20N2 and a molecular weight of 228.34 g/mol. Its IUPAC name is (2E,4E)-N,N-dimethyl-3-[(6-methylidenecyclohexa-2,4-dien-1-ylidene)amino]hexa-2,4-dien-2-amine.
| Compound Name | (2E,4E)-N,N-dimethyl-3-[(6-methylidenecyclohexa-2,4-dien-1-ylidene)amino]hexa-2,4-dien-2-amine |
|---|---|
| PubChem CID | 89441651 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | (2E,4E)-N,N-dimethyl-3-[(6-methylidenecyclohexa-2,4-dien-1-ylidene)amino]hexa-2,4-dien-2-amine |
| SMILES | C=C1C=CC=C/C1=N\C(\C=C\C)=C(/C)N(C)C |
| InChI | InChI=1S/C15H20N2/c1-6-9-15(13(3)17(4)5)16-14-11-8-7-10-12(14)2/h6-11H,2H2,1,3-5H3/b9-6+,15-13+,16-14+ |
| InChIKey | VJTPGVMRJXDKKX-LCNUPHRXSA-N |
| XLogP | 3.48 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|