C13H16N2 — CID 89441659
(2Z,4E)-2-[(6-methylidenecyclohexa-2,4-dien-1-ylidene)amino]hexa-2,4-dien-3-amine (PubChem CID 89441659) has the molecular formula C13H16N2 and a molecular weight of 200.28 g/mol. Its IUPAC name is (2Z,4E)-2-[(6-methylidenecyclohexa-2,4-dien-1-ylidene)amino]hexa-2,4-dien-3-amine.
| Compound Name | (2Z,4E)-2-[(6-methylidenecyclohexa-2,4-dien-1-ylidene)amino]hexa-2,4-dien-3-amine |
|---|---|
| PubChem CID | 89441659 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | (2Z,4E)-2-[(6-methylidenecyclohexa-2,4-dien-1-ylidene)amino]hexa-2,4-dien-3-amine |
| SMILES | C=C1C=CC=C/C1=N\C(C)=C(N)\C=C\C |
| InChI | InChI=1S/C13H16N2/c1-4-7-12(14)11(3)15-13-9-6-5-8-10(13)2/h4-9H,2,14H2,1,3H3/b7-4+,12-11-,15-13+ |
| InChIKey | XHKTVKCHZHCNAO-ZXPQMYNGSA-N |
| XLogP | 2.88 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|