C23H28F3NO4 — CID 89441723
7-[(5R)-2-oxo-5-[(E)-3-oxo-4-[6-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]but-1-enyl]pyrrolidin-1-yl]heptanoic acid (PubChem CID 89441723) has the molecular formula C23H28F3NO4 and a molecular weight of 439.47 g/mol. Its IUPAC name is 7-[(5R)-2-oxo-5-[(E)-3-oxo-4-[6-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]but-1-enyl]pyrrolidin-1-yl]heptanoic acid.
| Compound Name | 7-[(5R)-2-oxo-5-[(E)-3-oxo-4-[6-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]but-1-enyl]pyrrolidin-1-yl]heptanoic acid |
|---|---|
| PubChem CID | 89441723 |
| Molecular Formula | C23H28F3NO4 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | 7-[(5R)-2-oxo-5-[(E)-3-oxo-4-[6-(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]but-1-enyl]pyrrolidin-1-yl]heptanoic acid |
| SMILES | O=C(O)CCCCCCN1C(=O)CC[C@@H]1/C=C/C(=O)CC1=CCC=CC(C(F)(F)F)=C1 |
| InChI | InChI=1S/C23H28F3NO4/c24-23(25,26)18-8-5-4-7-17(15-18)16-20(28)12-10-19-11-13-21(29)27(19)14-6-2-1-3-9-22(30)31/h5,7-8,10,12,15,19H,1-4,6,9,11,13-14,16H2,(H,30,31)/b12-10+/t19-/m0/s1 |
| InChIKey | VRDPAONFWWZXQI-RDELFYGPSA-N |
| XLogP | 4.90 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|