C22H22N5O4S+ — CID 89441850
[4-[2-[[5-(2-hydroxyethyl)-16-thia-4,5,12,14-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),3,10,12,14-hexaen-11-yl]oxy]ethyl]phenyl]-methoxy-oxoazanium (PubChem CID 89441850) has the molecular formula C22H22N5O4S+ and a molecular weight of 452.52 g/mol. Its IUPAC name is [4-[2-[[5-(2-hydroxyethyl)-16-thia-4,5,12,14-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),3,10,12,14-hexaen-11-yl]oxy]ethyl]phenyl]-methoxy-oxoazanium.
| Compound Name | [4-[2-[[5-(2-hydroxyethyl)-16-thia-4,5,12,14-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),3,10,12,14-hexaen-11-yl]oxy]ethyl]phenyl]-methoxy-oxoazanium |
|---|---|
| PubChem CID | 89441850 |
| Molecular Formula | C22H22N5O4S+ |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | [4-[2-[[5-(2-hydroxyethyl)-16-thia-4,5,12,14-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),3,10,12,14-hexaen-11-yl]oxy]ethyl]phenyl]-methoxy-oxoazanium |
| SMILES | CO[N+](=O)c1ccc(CCOc2ncnc3sc4c(c23)CCc2c-4cnn2CCO)cc1 |
| InChI | InChI=1S/C22H22N5O4S/c1-30-27(29)15-4-2-14(3-5-15)8-11-31-21-19-16-6-7-18-17(12-25-26(18)9-10-28)20(16)32-22(19)24-13-23-21/h2-5,12-13,28H,6-11H2,1H3/q+1 |
| InChIKey | CPFUKWIMSWEZSX-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|