C8H10N2OS2 — CID 89441937
3,4-diethynyl-2,5-dimethyl-1-sulfanylidene-1,2,5-thiadiazolidine 1-oxide (PubChem CID 89441937) has the molecular formula C8H10N2OS2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 3,4-diethynyl-2,5-dimethyl-1-sulfanylidene-1,2,5-thiadiazolidine 1-oxide.
| Compound Name | 3,4-diethynyl-2,5-dimethyl-1-sulfanylidene-1,2,5-thiadiazolidine 1-oxide |
|---|---|
| PubChem CID | 89441937 |
| Molecular Formula | C8H10N2OS2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.02 |
| IUPAC Name | 3,4-diethynyl-2,5-dimethyl-1-sulfanylidene-1,2,5-thiadiazolidine 1-oxide |
| SMILES | C#CC1C(C#C)N(C)S(=O)(=S)N1C |
| InChI | InChI=1S/C8H10N2OS2/c1-5-7-8(6-2)10(4)13(11,12)9(7)3/h1-2,7-8H,3-4H3 |
| InChIKey | BOIDRBBUJNHAPT-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|