C9H13N2PS — CID 89441970
4,5-diethynyl-1,2,3-trimethyl-2-sulfanylidene-1,3,2λ5-diazaphospholidine (PubChem CID 89441970) has the molecular formula C9H13N2PS and a molecular weight of 212.26 g/mol. Its IUPAC name is 4,5-diethynyl-1,2,3-trimethyl-2-sulfanylidene-1,3,2λ5-diazaphospholidine.
| Compound Name | 4,5-diethynyl-1,2,3-trimethyl-2-sulfanylidene-1,3,2λ5-diazaphospholidine |
|---|---|
| PubChem CID | 89441970 |
| Molecular Formula | C9H13N2PS |
| Molecular Weight | 212.26 g/mol |
| Exact Mass | 212.05 |
| IUPAC Name | 4,5-diethynyl-1,2,3-trimethyl-2-sulfanylidene-1,3,2λ5-diazaphospholidine |
| SMILES | C#CC1C(C#C)N(C)P(C)(=S)N1C |
| InChI | InChI=1S/C9H13N2PS/c1-6-8-9(7-2)11(4)12(5,13)10(8)3/h1-2,8-9H,3-5H3 |
| InChIKey | FJHVUYSQSYCFOY-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.26 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|